morpholine, 3-(1-methylethyl)-, (3R)-
(3R)-3-isopropylmorpholine
CAS: 74572-01-3
Molecular Formula: C7H15NO
morpholine, 3-(1-methylethyl)-, (3R)- - Names and Identifiers
| Name | (3R)-3-isopropylmorpholine |
| Synonyms | (R)-3-Isopropylmorpholine (3R)-3-isopropylmorpholine (R)-3-ISOPROPYLMORPHOLINE, (3R)-3-(Propan-2-yl)morpholine (R)-3-(1-Methylethyl)morpholine (3R)-3-(1-methylethyl)-Morpholine Morpholine, 3-(1-methylethyl)-, (3R)- morpholine, 3-(1-methylethyl)-, (3R)- |
| CAS | 74572-01-3 |
| InChI | InChI=1/C7H15NO/c1-6(2)7-5-9-4-3-8-7/h6-8H,3-5H2,1-2H3/t7-/m0/s1 |
morpholine, 3-(1-methylethyl)-, (3R)- - Physico-chemical Properties
| Molecular Formula | C7H15NO |
| Molar Mass | 129.2 |
| Density | 0.887g/cm3 |
| Boling Point | 175.2°C at 760 mmHg |
| Flash Point | 63.2°C |
| Vapor Presure | 1.16mmHg at 25°C |
| Storage Condition | 2-8°C |
| Refractive Index | 1.425 |
morpholine, 3-(1-methylethyl)-, (3R)- - Introduction
(3R)-3-isopropylmorpholine ((3R)-3-isopropylmorpholine) is an organic compound with the following properties:
1. appearance: colorless liquid.
2. molecular formula: C8H17NO.
3. Molecular weight: 143.23g/mol.
4. Melting point:-43°C.
5. Boiling point: 188°C.
6. Density: 0.884 g/mL.
The use of this compound includes the following aspects:
1. Solvent: Due to the characteristics of its organic solvent, it can be used as a dissolving agent in organic synthesis reactions.
2. Catalyst: It can be used as a catalyst, especially in asymmetric catalytic reactions in polymer chemistry and organic synthesis.
3. pharmaceutical field: in the preparation of some drugs, such as some anti-cancer drugs.
The method of preparing (3R)-3-isopropylmorpholine can be through the following steps:
1. The morpholine and isopropyl bromide react under alkaline conditions to generate (3R)-3-isopropylmorpholine.
2. The reaction can be initiated by using sodium hydride as a base catalyst.
However, safety data on (3R)-3-isopropylmorpholine are relatively limited. Based on the study of some related structurally similar compounds, it is expected that it may be irritating to the eyes and skin, and may have some acute toxicity. Therefore, appropriate safety measures should be taken during use and handling, such as wearing protective gloves, goggles and protective clothing, and ensuring that the operation is carried out in a well-ventilated area.
1. appearance: colorless liquid.
2. molecular formula: C8H17NO.
3. Molecular weight: 143.23g/mol.
4. Melting point:-43°C.
5. Boiling point: 188°C.
6. Density: 0.884 g/mL.
The use of this compound includes the following aspects:
1. Solvent: Due to the characteristics of its organic solvent, it can be used as a dissolving agent in organic synthesis reactions.
2. Catalyst: It can be used as a catalyst, especially in asymmetric catalytic reactions in polymer chemistry and organic synthesis.
3. pharmaceutical field: in the preparation of some drugs, such as some anti-cancer drugs.
The method of preparing (3R)-3-isopropylmorpholine can be through the following steps:
1. The morpholine and isopropyl bromide react under alkaline conditions to generate (3R)-3-isopropylmorpholine.
2. The reaction can be initiated by using sodium hydride as a base catalyst.
However, safety data on (3R)-3-isopropylmorpholine are relatively limited. Based on the study of some related structurally similar compounds, it is expected that it may be irritating to the eyes and skin, and may have some acute toxicity. Therefore, appropriate safety measures should be taken during use and handling, such as wearing protective gloves, goggles and protective clothing, and ensuring that the operation is carried out in a well-ventilated area.
Last Update：2024-04-10 22:41:03
Supplier List
Product Name: (R)-3-ISOPROPYLMORPHOLINE, Visit Supplier Webpage Request for quotation
CAS: 74572-01-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 74572-01-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: (R)-3-ISOPROPYLMORPHOLINE, Visit Supplier Webpage Request for quotation
CAS: 74572-01-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 74572-01-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History